C24H25N3O7S — CID 14788026
5-O-ethyl 3-O-methyl 2-[(4-methoxyphenyl)methylsulfanyl]-6-methyl-4-(3-nitrophenyl)-4H-pyrimidine-3,5-dicarboxylate (PubChem CID 14788026) has the molecular formula C24H25N3O7S and a molecular weight of 499.55 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2-[(4-methoxyphenyl)methylsulfanyl]-6-methyl-4-(3-nitrophenyl)-4H-pyrimidine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2-[(4-methoxyphenyl)methylsulfanyl]-6-methyl-4-(3-nitrophenyl)-4H-pyrimidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14788026 |
| Molecular Formula | C24H25N3O7S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2-[(4-methoxyphenyl)methylsulfanyl]-6-methyl-4-(3-nitrophenyl)-4H-pyrimidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C(SCc2ccc(OC)cc2)N(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H25N3O7S/c1-5-34-22(28)20-15(2)25-23(35-14-16-9-11-19(32-3)12-10-16)26(24(29)33-4)21(20)17-7-6-8-18(13-17)27(30)31/h6-13,21H,5,14H2,1-4H3 |
| InChIKey | HYSPCMLYMJPMHJ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 120.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|