C22H17Cl2N3O4S — CID 118943802
ethyl 3-(3,4-dichlorophenyl)-7-methyl-5-(3-nitrophenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 118943802) has the molecular formula C22H17Cl2N3O4S and a molecular weight of 490.37 g/mol. Its IUPAC name is ethyl 3-(3,4-dichlorophenyl)-7-methyl-5-(3-nitrophenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 3-(3,4-dichlorophenyl)-7-methyl-5-(3-nitrophenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 118943802 |
| Molecular Formula | C22H17Cl2N3O4S |
| Molecular Weight | 490.37 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | ethyl 3-(3,4-dichlorophenyl)-7-methyl-5-(3-nitrophenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C2SC=C(c3ccc(Cl)c(Cl)c3)N2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H17Cl2N3O4S/c1-3-31-21(28)19-12(2)25-22-26(20(19)14-5-4-6-15(9-14)27(29)30)18(11-32-22)13-7-8-16(23)17(24)10-13/h4-11,20H,3H2,1-2H3 |
| InChIKey | YACUZEJOWGBSBV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.37 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|