C29H29N5O6S — CID 98210108
ethyl (5R)-3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-5-(3-nitrophenyl)-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98210108) has the molecular formula C29H29N5O6S and a molecular weight of 575.65 g/mol. Its IUPAC name is ethyl (5R)-3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-5-(3-nitrophenyl)-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5R)-3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-5-(3-nitrophenyl)-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98210108 |
| Molecular Formula | C29H29N5O6S |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | ethyl (5R)-3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-5-(3-nitrophenyl)-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=C2SC=C(CC(=O)N3CCN(C(C)=O)CC3)N2[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H29N5O6S/c1-3-40-28(37)25-26(20-8-5-4-6-9-20)30-29-33(27(25)21-10-7-11-22(16-21)34(38)39)23(18-41-29)17-24(36)32-14-12-31(13-15-32)19(2)35/h4-11,16,18,27H,3,12-15,17H2,1-2H3/t27-/m1/s1 |
| InChIKey | AAYKFEUDXJADQE-HHHXNRCGSA-N |
| XLogP | 3.95 |
| TPSA | 125.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|