C23H24N4O5S — CID 42830067
prop-2-enyl 7-methyl-5-(3-nitrophenyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 42830067) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is prop-2-enyl 7-methyl-5-(3-nitrophenyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 7-methyl-5-(3-nitrophenyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 42830067 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | prop-2-enyl 7-methyl-5-(3-nitrophenyl)-3-(2-oxo-2-pyrrolidin-1-ylethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)N=C2SC=C(CC(=O)N3CCCC3)N2C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H24N4O5S/c1-3-11-32-22(29)20-15(2)24-23-26(21(20)16-7-6-8-17(12-16)27(30)31)18(14-33-23)13-19(28)25-9-4-5-10-25/h3,6-8,12,14,21H,1,4-5,9-11,13H2,2H3 |
| InChIKey | MSCMQPQUOZHSGW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|