C26H26N4O5S — CID 98425442
ethyl (5S)-3-[2-[ethyl(methyl)amino]-2-oxoethyl]-5-(3-nitrophenyl)-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 98425442) has the molecular formula C26H26N4O5S and a molecular weight of 506.58 g/mol. Its IUPAC name is ethyl (5S)-3-[2-[ethyl(methyl)amino]-2-oxoethyl]-5-(3-nitrophenyl)-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5S)-3-[2-[ethyl(methyl)amino]-2-oxoethyl]-5-(3-nitrophenyl)-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 98425442 |
| Molecular Formula | C26H26N4O5S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | ethyl (5S)-3-[2-[ethyl(methyl)amino]-2-oxoethyl]-5-(3-nitrophenyl)-7-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)N=C2SC=C(CC(=O)N(C)CC)N2[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H26N4O5S/c1-4-28(3)21(31)15-20-16-36-26-27-23(17-10-7-6-8-11-17)22(25(32)35-5-2)24(29(20)26)18-12-9-13-19(14-18)30(33)34/h6-14,16,24H,4-5,15H2,1-3H3/t24-/m0/s1 |
| InChIKey | ZSIVKYADKZWNTP-DEOSSOPVSA-N |
| XLogP | 4.74 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|