C16H18N4O6 — CID 11371892
propan-2-yl (4R)-3-carbamoyl-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 11371892) has the molecular formula C16H18N4O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is propan-2-yl (4R)-3-carbamoyl-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | propan-2-yl (4R)-3-carbamoyl-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 11371892 |
| Molecular Formula | C16H18N4O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | propan-2-yl (4R)-3-carbamoyl-6-methyl-4-(3-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)[C@@H](c2cccc([N+](=O)[O-])c2)N(C(N)=O)C(=O)N1 |
| InChI | InChI=1S/C16H18N4O6/c1-8(2)26-14(21)12-9(3)18-16(23)19(15(17)22)13(12)10-5-4-6-11(7-10)20(24)25/h4-8,13H,1-3H3,(H2,17,22)(H,18,23)/t13-/m1/s1 |
| InChIKey | JTILQSIVPVPOTG-CYBMUJFWSA-N |
| XLogP | 1.97 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|