C25H28N2O7 — CID 40962090
diethyl (1S,2S,6R)-4-anilino-6-hydroxy-6-methyl-2-(3-nitrophenyl)cyclohex-3-ene-1,3-dicarboxylate (PubChem CID 40962090) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is diethyl (1S,2S,6R)-4-anilino-6-hydroxy-6-methyl-2-(3-nitrophenyl)cyclohex-3-ene-1,3-dicarboxylate.
| Compound Name | diethyl (1S,2S,6R)-4-anilino-6-hydroxy-6-methyl-2-(3-nitrophenyl)cyclohex-3-ene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 40962090 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | diethyl (1S,2S,6R)-4-anilino-6-hydroxy-6-methyl-2-(3-nitrophenyl)cyclohex-3-ene-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(Nc2ccccc2)C[C@@](C)(O)[C@@H](C(=O)OCC)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H28N2O7/c1-4-33-23(28)21-19(26-17-11-7-6-8-12-17)15-25(3,30)22(24(29)34-5-2)20(21)16-10-9-13-18(14-16)27(31)32/h6-14,20,22,26,30H,4-5,15H2,1-3H3/t20-,22+,25+/m0/s1 |
| InChIKey | CWBFOZNZYALHJC-NIRIFSCTSA-N |
| XLogP | 3.94 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|