C35H40N4O6 — CID 69492439
5-O-ethyl 3-O-methyl 2-(4-benzhydrylpiperazin-1-yl)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 69492439) has the molecular formula C35H40N4O6 and a molecular weight of 612.73 g/mol. Its IUPAC name is 5-O-ethyl 3-O-methyl 2-(4-benzhydrylpiperazin-1-yl)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-methyl 2-(4-benzhydrylpiperazin-1-yl)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 69492439 |
| Molecular Formula | C35H40N4O6 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.29 |
| IUPAC Name | 5-O-ethyl 3-O-methyl 2-(4-benzhydrylpiperazin-1-yl)-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)(N2CCN(C(c3ccccc3)c3ccccc3)CC2)C(C(=O)OC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H40N4O6/c1-5-45-33(40)29-24(2)36-35(3,31(34(41)44-4)30(29)27-17-12-18-28(23-27)39(42)43)38-21-19-37(20-22-38)32(25-13-8-6-9-14-25)26-15-10-7-11-16-26/h6-18,23,30-32,36H,5,19-22H2,1-4H3 |
| InChIKey | VQGQPBHAOJTEKY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|