C32H38FN3O8 — CID 70474140
5-O-ethyl 3-O-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl] 2-methoxy-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate (PubChem CID 70474140) has the molecular formula C32H38FN3O8 and a molecular weight of 611.67 g/mol. Its IUPAC name is 5-O-ethyl 3-O-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl] 2-methoxy-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate.
| Compound Name | 5-O-ethyl 3-O-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl] 2-methoxy-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70474140 |
| Molecular Formula | C32H38FN3O8 |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 5-O-ethyl 3-O-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl] 2-methoxy-2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)(OC)C(C(=O)OCCN2CCC(C(=O)c3ccc(F)cc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C32H38FN3O8/c1-5-43-30(38)26-20(2)34-32(3,42-4)28(27(26)23-7-6-8-25(19-23)36(40)41)31(39)44-18-17-35-15-13-22(14-16-35)29(37)21-9-11-24(33)12-10-21/h6-12,19,22,27-28,34H,5,13-18H2,1-4H3 |
| InChIKey | KSMYUPQWRDMQPH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|