C22H21N3O6 — CID 124776135
benzyl (4R,5R,6S)-6-hydroxy-6-methyl-4-(3-nitrophenyl)-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 124776135) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is benzyl (4R,5R,6S)-6-hydroxy-6-methyl-4-(3-nitrophenyl)-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | benzyl (4R,5R,6S)-6-hydroxy-6-methyl-4-(3-nitrophenyl)-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 124776135 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | benzyl (4R,5R,6S)-6-hydroxy-6-methyl-4-(3-nitrophenyl)-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | C[C@]1(O)Cc2[nH][nH]c(=O)c2[C@@H](c2cccc([N+](=O)[O-])c2)[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H21N3O6/c1-22(28)11-16-18(20(26)24-23-16)17(14-8-5-9-15(10-14)25(29)30)19(22)21(27)31-12-13-6-3-2-4-7-13/h2-10,17,19,28H,11-12H2,1H3,(H2,23,24,26)/t17-,19+,22+/m1/s1 |
| InChIKey | ZYPOEUOMOZLPGD-LZNRXBQRSA-N |
| XLogP | 2.41 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|