C22H28N2O4 — CID 98427797
prop-2-enyl (4R,5R,6R)-4-(4-tert-butylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 98427797) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is prop-2-enyl (4R,5R,6R)-4-(4-tert-butylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | prop-2-enyl (4R,5R,6R)-4-(4-tert-butylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 98427797 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | prop-2-enyl (4R,5R,6R)-4-(4-tert-butylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1[C@H](c2ccc(C(C)(C)C)cc2)c2c([nH][nH]c2=O)C[C@@]1(C)O |
| InChI | InChI=1S/C22H28N2O4/c1-6-11-28-20(26)18-16(13-7-9-14(10-8-13)21(2,3)4)17-15(12-22(18,5)27)23-24-19(17)25/h6-10,16,18,27H,1,11-12H2,2-5H3,(H2,23,24,25)/t16-,18+,22-/m1/s1 |
| InChIKey | RXEFEKFVTCJSBE-TVTNDZMWSA-N |
| XLogP | 2.78 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|