C20H26N2O4 — CID 97182574
propan-2-yl (4S,5R,6R)-4-(4-ethylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 97182574) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is propan-2-yl (4S,5R,6R)-4-(4-ethylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | propan-2-yl (4S,5R,6R)-4-(4-ethylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 97182574 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | propan-2-yl (4S,5R,6R)-4-(4-ethylphenyl)-6-hydroxy-6-methyl-3-oxo-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | CCc1ccc([C@H]2c3c([nH][nH]c3=O)C[C@@](C)(O)[C@@H]2C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O4/c1-5-12-6-8-13(9-7-12)15-16-14(21-22-18(16)23)10-20(4,25)17(15)19(24)26-11(2)3/h6-9,11,15,17,25H,5,10H2,1-4H3,(H2,21,22,23)/t15-,17-,20+/m0/s1 |
| InChIKey | NALFAXLZETUAFN-RIFZZMRRSA-N |
| XLogP | 2.27 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |