C25H28N2O4 — CID 92669997
benzyl (4R,5S,6S)-6-hydroxy-6-methyl-3-oxo-4-(4-propan-2-ylphenyl)-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate (PubChem CID 92669997) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is benzyl (4R,5S,6S)-6-hydroxy-6-methyl-3-oxo-4-(4-propan-2-ylphenyl)-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate.
| Compound Name | benzyl (4R,5S,6S)-6-hydroxy-6-methyl-3-oxo-4-(4-propan-2-ylphenyl)-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 92669997 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | benzyl (4R,5S,6S)-6-hydroxy-6-methyl-3-oxo-4-(4-propan-2-ylphenyl)-2,4,5,7-tetrahydro-1H-indazole-5-carboxylate |
| SMILES | CC(C)c1ccc([C@@H]2c3c([nH][nH]c3=O)C[C@](C)(O)[C@H]2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-15(2)17-9-11-18(12-10-17)20-21-19(26-27-23(21)28)13-25(3,30)22(20)24(29)31-14-16-7-5-4-6-8-16/h4-12,15,20,22,30H,13-14H2,1-3H3,(H2,26,27,28)/t20-,22-,25+/m1/s1 |
| InChIKey | DGOHFJNZQHXKBT-LFAGZIFBSA-N |
| XLogP | 3.62 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |