C32H34O6 — CID 124908226
dibenzyl (1S,2S,3S,4S)-4-hydroxy-4-methyl-6-oxo-2-(4-propan-2-ylphenyl)cyclohexane-1,3-dicarboxylate (PubChem CID 124908226) has the molecular formula C32H34O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is dibenzyl (1S,2S,3S,4S)-4-hydroxy-4-methyl-6-oxo-2-(4-propan-2-ylphenyl)cyclohexane-1,3-dicarboxylate.
| Compound Name | dibenzyl (1S,2S,3S,4S)-4-hydroxy-4-methyl-6-oxo-2-(4-propan-2-ylphenyl)cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 124908226 |
| Molecular Formula | C32H34O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | dibenzyl (1S,2S,3S,4S)-4-hydroxy-4-methyl-6-oxo-2-(4-propan-2-ylphenyl)cyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)c1ccc([C@@H]2[C@H](C(=O)OCc3ccccc3)C(=O)C[C@](C)(O)[C@H]2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H34O6/c1-21(2)24-14-16-25(17-15-24)27-28(30(34)37-19-22-10-6-4-7-11-22)26(33)18-32(3,36)29(27)31(35)38-20-23-12-8-5-9-13-23/h4-17,21,27-29,36H,18-20H2,1-3H3/t27-,28-,29-,32+/m1/s1 |
| InChIKey | LPGUAYDYGKSYCM-OGQOOFKISA-N |
| XLogP | 5.34 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|