C31H32O8 — CID 98260469
dibenzyl (1R,2R,3R,4R)-2-(3,4-dimethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 98260469) has the molecular formula C31H32O8 and a molecular weight of 532.59 g/mol. Its IUPAC name is dibenzyl (1R,2R,3R,4R)-2-(3,4-dimethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | dibenzyl (1R,2R,3R,4R)-2-(3,4-dimethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 98260469 |
| Molecular Formula | C31H32O8 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | dibenzyl (1R,2R,3R,4R)-2-(3,4-dimethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | COc1ccc([C@H]2[C@@H](C(=O)OCc3ccccc3)C(=O)C[C@@](C)(O)[C@@H]2C(=O)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C31H32O8/c1-31(35)17-23(32)27(29(33)38-18-20-10-6-4-7-11-20)26(22-14-15-24(36-2)25(16-22)37-3)28(31)30(34)39-19-21-12-8-5-9-13-21/h4-16,26-28,35H,17-19H2,1-3H3/t26-,27-,28-,31+/m0/s1 |
| InChIKey | QHMMCAGXYPABNG-WKUVLXMOSA-N |
| XLogP | 4.23 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|