C30H30O6 — CID 3994100
dibenzyl 4-hydroxy-4-methyl-2-(4-methylphenyl)-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 3994100) has the molecular formula C30H30O6 and a molecular weight of 486.56 g/mol. Its IUPAC name is dibenzyl 4-hydroxy-4-methyl-2-(4-methylphenyl)-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | dibenzyl 4-hydroxy-4-methyl-2-(4-methylphenyl)-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3994100 |
| Molecular Formula | C30H30O6 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | dibenzyl 4-hydroxy-4-methyl-2-(4-methylphenyl)-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | Cc1ccc(C2C(C(=O)OCc3ccccc3)C(=O)CC(C)(O)C2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H30O6/c1-20-13-15-23(16-14-20)25-26(28(32)35-18-21-9-5-3-6-10-21)24(31)17-30(2,34)27(25)29(33)36-19-22-11-7-4-8-12-22/h3-16,25-27,34H,17-19H2,1-2H3 |
| InChIKey | XEIDHZMMUBWCJT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|