C31H33NO6 — CID 26314085
dibenzyl (1S,2S,3R,4R,6E)-2-(4-ethylphenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate (PubChem CID 26314085) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is dibenzyl (1S,2S,3R,4R,6E)-2-(4-ethylphenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate.
| Compound Name | dibenzyl (1S,2S,3R,4R,6E)-2-(4-ethylphenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 26314085 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | dibenzyl (1S,2S,3R,4R,6E)-2-(4-ethylphenyl)-4-hydroxy-6-hydroxyimino-4-methylcyclohexane-1,3-dicarboxylate |
| SMILES | CCc1ccc([C@H]2[C@H](C(=O)OCc3ccccc3)/C(=N/O)C[C@@](C)(O)[C@@H]2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H33NO6/c1-3-21-14-16-24(17-15-21)26-27(29(33)37-19-22-10-6-4-7-11-22)25(32-36)18-31(2,35)28(26)30(34)38-20-23-12-8-5-9-13-23/h4-17,26-28,35-36H,3,18-20H2,1-2H3/b32-25+/t26-,27+,28-,31+/m0/s1 |
| InChIKey | JDZWLJZLGGZOTN-NSGCBXAZSA-N |
| XLogP | 5.04 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|