C23H26N2O5 — CID 51688439
dimethyl (1R,2S,3S,4S,6Z)-4-hydroxy-4-methyl-2-phenyl-6-(phenylhydrazinylidene)cyclohexane-1,3-dicarboxylate (PubChem CID 51688439) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is dimethyl (1R,2S,3S,4S,6Z)-4-hydroxy-4-methyl-2-phenyl-6-(phenylhydrazinylidene)cyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3S,4S,6Z)-4-hydroxy-4-methyl-2-phenyl-6-(phenylhydrazinylidene)cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 51688439 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | dimethyl (1R,2S,3S,4S,6Z)-4-hydroxy-4-methyl-2-phenyl-6-(phenylhydrazinylidene)cyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1/C(=N\Nc2ccccc2)C[C@](C)(O)[C@@H](C(=O)OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H26N2O5/c1-23(28)14-17(25-24-16-12-8-5-9-13-16)19(21(26)29-2)18(20(23)22(27)30-3)15-10-6-4-7-11-15/h4-13,18-20,24,28H,14H2,1-3H3/b25-17-/t18-,19-,20+,23-/m0/s1 |
| InChIKey | FNQSYUISCOHNER-REABBXRWSA-N |
| XLogP | 2.97 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|