C28H36N2O7S — CID 16766012
dipropan-2-yl (6E)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylcyclohexane-1,3-dicarboxylate (PubChem CID 16766012) has the molecular formula C28H36N2O7S and a molecular weight of 544.67 g/mol. Its IUPAC name is dipropan-2-yl (6E)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylcyclohexane-1,3-dicarboxylate.
| Compound Name | dipropan-2-yl (6E)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 16766012 |
| Molecular Formula | C28H36N2O7S |
| Molecular Weight | 544.67 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | dipropan-2-yl (6E)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylcyclohexane-1,3-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\CC(C)(O)C(C(=O)OC(C)C)C(c3ccccc3)C2C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C28H36N2O7S/c1-17(2)36-26(31)24-22(29-30-38(34,35)21-14-12-19(5)13-15-21)16-28(6,33)25(27(32)37-18(3)4)23(24)20-10-8-7-9-11-20/h7-15,17-18,23-25,30,33H,16H2,1-6H3/b29-22+ |
| InChIKey | XCZXVTOPRQWHIW-QUPMIFSKSA-N |
| XLogP | 3.70 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|