C21H27NO8 — CID 42562699
dipropan-2-yl (1S,2S,3R,4S)-4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 42562699) has the molecular formula C21H27NO8 and a molecular weight of 421.45 g/mol. Its IUPAC name is dipropan-2-yl (1S,2S,3R,4S)-4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | dipropan-2-yl (1S,2S,3R,4S)-4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 42562699 |
| Molecular Formula | C21H27NO8 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | dipropan-2-yl (1S,2S,3R,4S)-4-hydroxy-4-methyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@H](C(=O)OC(C)C)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27NO8/c1-11(2)29-19(24)17-15(23)10-21(5,26)18(20(25)30-12(3)4)16(17)13-7-6-8-14(9-13)22(27)28/h6-9,11-12,16-18,26H,10H2,1-5H3/t16-,17-,18+,21+/m1/s1 |
| InChIKey | LTAJSQLTORSAHL-WIRSXHRWSA-N |
| XLogP | 2.54 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|