C23H31NO8 — CID 98345665
bis(2-methylpropyl) (1R,2S,3R,4R)-4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 98345665) has the molecular formula C23H31NO8 and a molecular weight of 449.50 g/mol. Its IUPAC name is bis(2-methylpropyl) (1R,2S,3R,4R)-4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | bis(2-methylpropyl) (1R,2S,3R,4R)-4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 98345665 |
| Molecular Formula | C23H31NO8 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | bis(2-methylpropyl) (1R,2S,3R,4R)-4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)COC(=O)[C@H]1C(=O)C[C@@](C)(O)[C@H](C(=O)OCC(C)C)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H31NO8/c1-13(2)11-31-21(26)19-17(25)10-23(5,28)20(22(27)32-12-14(3)4)18(19)15-6-8-16(9-7-15)24(29)30/h6-9,13-14,18-20,28H,10-12H2,1-5H3/t18-,19+,20+,23-/m1/s1 |
| InChIKey | FSIMUIITLVUBGL-QTDGGUCWSA-N |
| XLogP | 3.03 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|