C27H41NO6 — CID 3823692
bis(2-methylpropyl) 2-[4-(diethylamino)phenyl]-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 3823692) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is bis(2-methylpropyl) 2-[4-(diethylamino)phenyl]-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 2-[4-(diethylamino)phenyl]-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3823692 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | bis(2-methylpropyl) 2-[4-(diethylamino)phenyl]-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | CCN(CC)c1ccc(C2C(C(=O)OCC(C)C)C(=O)CC(C)(O)C2C(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C27H41NO6/c1-8-28(9-2)20-12-10-19(11-13-20)22-23(25(30)33-15-17(3)4)21(29)14-27(7,32)24(22)26(31)34-16-18(5)6/h10-13,17-18,22-24,32H,8-9,14-16H2,1-7H3 |
| InChIKey | LLYCKJVJWFLVCN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|