C17H21N3O6 — CID 93234677
(1S,2R,3S,4S)-4-hydroxy-1-N,3-N,4-trimethyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 93234677) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is (1S,2R,3S,4S)-4-hydroxy-1-N,3-N,4-trimethyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | (1S,2R,3S,4S)-4-hydroxy-1-N,3-N,4-trimethyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93234677 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (1S,2R,3S,4S)-4-hydroxy-1-N,3-N,4-trimethyl-2-(3-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@@H](C(=O)NC)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21N3O6/c1-17(24)8-11(21)13(15(22)18-2)12(14(17)16(23)19-3)9-5-4-6-10(7-9)20(25)26/h4-7,12-14,24H,8H2,1-3H3,(H,18,22)(H,19,23)/t12-,13+,14+,17-/m0/s1 |
| InChIKey | FLDMLTBKDNCSFC-CFAJVAMVSA-N |
| XLogP | 0.13 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|