C27H26N2O4 — CID 124755273
(1R,2R,3R,4S)-4-hydroxy-4-methyl-6-oxo-1-N,3-N,2-triphenylcyclohexane-1,3-dicarboxamide (PubChem CID 124755273) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is (1R,2R,3R,4S)-4-hydroxy-4-methyl-6-oxo-1-N,3-N,2-triphenylcyclohexane-1,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-4-hydroxy-4-methyl-6-oxo-1-N,3-N,2-triphenylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 124755273 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (1R,2R,3R,4S)-4-hydroxy-4-methyl-6-oxo-1-N,3-N,2-triphenylcyclohexane-1,3-dicarboxamide |
| SMILES | C[C@]1(O)CC(=O)[C@H](C(=O)Nc2ccccc2)[C@H](c2ccccc2)[C@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H26N2O4/c1-27(33)17-21(30)23(25(31)28-19-13-7-3-8-14-19)22(18-11-5-2-6-12-18)24(27)26(32)29-20-15-9-4-10-16-20/h2-16,22-24,33H,17H2,1H3,(H,28,31)(H,29,32)/t22-,23-,24-,27-/m0/s1 |
| InChIKey | QANDUNOCNUVCBG-TTZMFTMZSA-N |
| XLogP | 4.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|