C34H32N2O5 — CID 19225216
4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenyl-2-(3-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxamide (PubChem CID 19225216) has the molecular formula C34H32N2O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is 4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenyl-2-(3-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxamide.
| Compound Name | 4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenyl-2-(3-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19225216 |
| Molecular Formula | C34H32N2O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenyl-2-(3-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxamide |
| SMILES | CC1(O)CC(=O)C(C(=O)Nc2ccccc2)C(c2cccc(OCc3ccccc3)c2)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C34H32N2O5/c1-34(40)21-28(37)30(32(38)35-25-15-7-3-8-16-25)29(31(34)33(39)36-26-17-9-4-10-18-26)24-14-11-19-27(20-24)41-22-23-12-5-2-6-13-23/h2-20,29-31,40H,21-22H2,1H3,(H,35,38)(H,36,39) |
| InChIKey | URDHONZRHGIUHQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|