C38H40N2O5 — CID 19224983
1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-(3-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxamide (PubChem CID 19224983) has the molecular formula C38H40N2O5 and a molecular weight of 604.75 g/mol. Its IUPAC name is 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-(3-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-(3-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224983 |
| Molecular Formula | C38H40N2O5 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-(3-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2C(=O)CC(C)(O)C(C(=O)Nc3ccc(C)cc3C)C2c2cccc(OCc3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C38H40N2O5/c1-23-14-16-30(25(3)18-23)39-36(42)34-32(41)21-38(5,44)35(37(43)40-31-17-15-24(2)19-26(31)4)33(34)28-12-9-13-29(20-28)45-22-27-10-7-6-8-11-27/h6-20,33-35,44H,21-22H2,1-5H3,(H,39,42)(H,40,43) |
| InChIKey | LPZOXMYMLJZVAY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|