C33H36N2O6 — CID 19224947
methyl 4-[2,6-bis[(2,4-dimethylphenyl)carbamoyl]-3-hydroxy-3-methyl-5-oxocyclohexyl]benzoate (PubChem CID 19224947) has the molecular formula C33H36N2O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is methyl 4-[2,6-bis[(2,4-dimethylphenyl)carbamoyl]-3-hydroxy-3-methyl-5-oxocyclohexyl]benzoate.
| Compound Name | methyl 4-[2,6-bis[(2,4-dimethylphenyl)carbamoyl]-3-hydroxy-3-methyl-5-oxocyclohexyl]benzoate |
|---|---|
| PubChem CID | 19224947 |
| Molecular Formula | C33H36N2O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | methyl 4-[2,6-bis[(2,4-dimethylphenyl)carbamoyl]-3-hydroxy-3-methyl-5-oxocyclohexyl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(C(=O)Nc3ccc(C)cc3C)C(=O)CC(C)(O)C2C(=O)Nc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C33H36N2O6/c1-18-7-13-24(20(3)15-18)34-30(37)28-26(36)17-33(5,40)29(31(38)35-25-14-8-19(2)16-21(25)4)27(28)22-9-11-23(12-10-22)32(39)41-6/h7-16,27-29,40H,17H2,1-6H3,(H,34,37)(H,35,38) |
| InChIKey | NDNKSOQZXSAHFF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|