C37H46N2O6 — CID 19224988
1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-2-(4-methoxy-3-pentoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19224988) has the molecular formula C37H46N2O6 and a molecular weight of 614.78 g/mol. Its IUPAC name is 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-2-(4-methoxy-3-pentoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-2-(4-methoxy-3-pentoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224988 |
| Molecular Formula | C37H46N2O6 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.34 |
| IUPAC Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-2-(4-methoxy-3-pentoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCCCCOc1cc(C2C(C(=O)Nc3ccc(C)cc3C)C(=O)CC(C)(O)C2C(=O)Nc2ccc(C)cc2C)ccc1OC |
| InChI | InChI=1S/C37H46N2O6/c1-8-9-10-17-45-31-20-26(13-16-30(31)44-7)32-33(35(41)38-27-14-11-22(2)18-24(27)4)29(40)21-37(6,43)34(32)36(42)39-28-15-12-23(3)19-25(28)5/h11-16,18-20,32-34,43H,8-10,17,21H2,1-7H3,(H,38,41)(H,39,42) |
| InChIKey | OGHNCMSUJKOINZ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|