C38H47BrN2O6 — CID 19233629
2-(3-bromo-4-hexoxy-5-methoxyphenyl)-1-N,3-N-bis(2,3-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233629) has the molecular formula C38H47BrN2O6 and a molecular weight of 707.71 g/mol. Its IUPAC name is 2-(3-bromo-4-hexoxy-5-methoxyphenyl)-1-N,3-N-bis(2,3-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(3-bromo-4-hexoxy-5-methoxyphenyl)-1-N,3-N-bis(2,3-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233629 |
| Molecular Formula | C38H47BrN2O6 |
| Molecular Weight | 707.71 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | 2-(3-bromo-4-hexoxy-5-methoxyphenyl)-1-N,3-N-bis(2,3-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCCCCCOc1c(Br)cc(C2C(C(=O)Nc3cccc(C)c3C)C(=O)CC(C)(O)C2C(=O)Nc2cccc(C)c2C)cc1OC |
| InChI | InChI=1S/C38H47BrN2O6/c1-8-9-10-11-18-47-35-27(39)19-26(20-31(35)46-7)32-33(36(43)40-28-16-12-14-22(2)24(28)4)30(42)21-38(6,45)34(32)37(44)41-29-17-13-15-23(3)25(29)5/h12-17,19-20,32-34,45H,8-11,18,21H2,1-7H3,(H,40,43)(H,41,44) |
| InChIKey | GTBFIGMXVSDLGM-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.71 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|