C40H44N2O6 — CID 19233759
1-N,3-N-bis(2,3-dimethylphenyl)-2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233759) has the molecular formula C40H44N2O6 and a molecular weight of 648.80 g/mol. Its IUPAC name is 1-N,3-N-bis(2,3-dimethylphenyl)-2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,3-dimethylphenyl)-2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233759 |
| Molecular Formula | C40H44N2O6 |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.32 |
| IUPAC Name | 1-N,3-N-bis(2,3-dimethylphenyl)-2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1cc(C2C(C(=O)Nc3cccc(C)c3C)C(=O)CC(C)(O)C2C(=O)Nc2cccc(C)c2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C40H44N2O6/c1-7-47-34-21-29(19-20-33(34)48-23-28-15-9-8-10-16-28)35-36(38(44)41-30-17-11-13-24(2)26(30)4)32(43)22-40(6,46)37(35)39(45)42-31-18-12-14-25(3)27(31)5/h8-21,35-37,46H,7,22-23H2,1-6H3,(H,41,44)(H,42,45) |
| InChIKey | WQNVMUUVAHAOGC-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|