C38H40N2O8 — CID 19224897
2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19224897) has the molecular formula C38H40N2O8 and a molecular weight of 652.74 g/mol. Its IUPAC name is 2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224897 |
| Molecular Formula | C38H40N2O8 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.28 |
| IUPAC Name | 2-(3-ethoxy-4-phenylmethoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1cc(C2C(C(=O)Nc3ccccc3OC)C(=O)CC(C)(O)C2C(=O)Nc2ccccc2OC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C38H40N2O8/c1-5-47-32-21-25(19-20-31(32)48-23-24-13-7-6-8-14-24)33-34(36(42)39-26-15-9-11-17-29(26)45-3)28(41)22-38(2,44)35(33)37(43)40-27-16-10-12-18-30(27)46-4/h6-21,33-35,44H,5,22-23H2,1-4H3,(H,39,42)(H,40,43) |
| InChIKey | HZQMZVPVOQZTMX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|