C32H36N2O8 — CID 19224844
2-(4-ethoxy-3-methoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19224844) has the molecular formula C32H36N2O8 and a molecular weight of 576.65 g/mol. Its IUPAC name is 2-(4-ethoxy-3-methoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(4-ethoxy-3-methoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224844 |
| Molecular Formula | C32H36N2O8 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 2-(4-ethoxy-3-methoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1ccc(C2C(C(=O)Nc3ccccc3OC)C(=O)CC(C)(O)C2C(=O)Nc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C32H36N2O8/c1-6-42-25-16-15-19(17-26(25)41-5)27-28(30(36)33-20-11-7-9-13-23(20)39-3)22(35)18-32(2,38)29(27)31(37)34-21-12-8-10-14-24(21)40-4/h7-17,27-29,38H,6,18H2,1-5H3,(H,33,36)(H,34,37) |
| InChIKey | JNSGOENMWKGXEU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|