C39H42N2O7 — CID 19233934
1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-2-[3-[(2-methylphenyl)methoxy]phenyl]-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233934) has the molecular formula C39H42N2O7 and a molecular weight of 650.77 g/mol. Its IUPAC name is 1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-2-[3-[(2-methylphenyl)methoxy]phenyl]-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-2-[3-[(2-methylphenyl)methoxy]phenyl]-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233934 |
| Molecular Formula | C39H42N2O7 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.30 |
| IUPAC Name | 1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-2-[3-[(2-methylphenyl)methoxy]phenyl]-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2OCC)C1c1cccc(OCc2ccccc2C)c1 |
| InChI | InChI=1S/C39H42N2O7/c1-5-46-32-20-11-9-18-29(32)40-37(43)35-31(42)23-39(4,45)36(38(44)41-30-19-10-12-21-33(30)47-6-2)34(35)26-16-13-17-28(22-26)48-24-27-15-8-7-14-25(27)3/h7-22,34-36,45H,5-6,23-24H2,1-4H3,(H,40,43)(H,41,44) |
| InChIKey | UCXMQUPSMHOFTF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|