C37H38N2O5 — CID 19225112
4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-2-[4-[(2-methylphenyl)methoxy]phenyl]-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19225112) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is 4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-2-[4-[(2-methylphenyl)methoxy]phenyl]-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-2-[4-[(2-methylphenyl)methoxy]phenyl]-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19225112 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-2-[4-[(2-methylphenyl)methoxy]phenyl]-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccccc1COc1ccc(C2C(C(=O)Nc3ccccc3C)C(=O)CC(C)(O)C2C(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C37H38N2O5/c1-23-11-5-8-14-27(23)22-44-28-19-17-26(18-20-28)32-33(35(41)38-29-15-9-6-12-24(29)2)31(40)21-37(4,43)34(32)36(42)39-30-16-10-7-13-25(30)3/h5-20,32-34,43H,21-22H2,1-4H3,(H,38,41)(H,39,42) |
| InChIKey | RDQHBLQAUMTYOG-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|