C41H46N2O5 — CID 19233893
1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-[4-[(2,4,5-trimethylphenyl)methoxy]phenyl]cyclohexane-1,3-dicarboxamide (PubChem CID 19233893) has the molecular formula C41H46N2O5 and a molecular weight of 646.83 g/mol. Its IUPAC name is 1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-[4-[(2,4,5-trimethylphenyl)methoxy]phenyl]cyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-[4-[(2,4,5-trimethylphenyl)methoxy]phenyl]cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233893 |
| Molecular Formula | C41H46N2O5 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | 1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-[4-[(2,4,5-trimethylphenyl)methoxy]phenyl]cyclohexane-1,3-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2CC)C1c1ccc(OCc2cc(C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C41H46N2O5/c1-7-28-13-9-11-15-33(28)42-39(45)37-35(44)23-41(6,47)38(40(46)43-34-16-12-10-14-29(34)8-2)36(37)30-17-19-32(20-18-30)48-24-31-22-26(4)25(3)21-27(31)5/h9-22,36-38,47H,7-8,23-24H2,1-6H3,(H,42,45)(H,43,46) |
| InChIKey | NOMUXQKKWXEAGL-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|