C38H39ClN2O7 — CID 19233536
2-[4-[(2-chlorophenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233536) has the molecular formula C38H39ClN2O7 and a molecular weight of 671.19 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-[4-[(2-chlorophenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233536 |
| Molecular Formula | C38H39ClN2O7 |
| Molecular Weight | 671.19 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2OCC)C1c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C38H39ClN2O7/c1-4-46-31-16-10-8-14-28(31)40-36(43)34-30(42)22-38(3,45)35(37(44)41-29-15-9-11-17-32(29)47-5-2)33(34)24-18-20-26(21-19-24)48-23-25-12-6-7-13-27(25)39/h6-21,33-35,45H,4-5,22-23H2,1-3H3,(H,40,43)(H,41,44) |
| InChIKey | VPIZNFHKMIPATJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.19 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|