C42H48N2O5 — CID 19233881
2-[4-[(4-tert-butylphenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233881) has the molecular formula C42H48N2O5 and a molecular weight of 660.86 g/mol. Its IUPAC name is 2-[4-[(4-tert-butylphenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-[4-[(4-tert-butylphenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233881 |
| Molecular Formula | C42H48N2O5 |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.36 |
| IUPAC Name | 2-[4-[(4-tert-butylphenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2CC)C1c1ccc(OCc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C42H48N2O5/c1-7-28-13-9-11-15-33(28)43-39(46)37-35(45)25-42(6,48)38(40(47)44-34-16-12-10-14-29(34)8-2)36(37)30-19-23-32(24-20-30)49-26-27-17-21-31(22-18-27)41(3,4)5/h9-24,36-38,48H,7-8,25-26H2,1-6H3,(H,43,46)(H,44,47) |
| InChIKey | QDASHVZRTXXHMY-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|