C24H26O7 — CID 3727388
dimethyl 4-hydroxy-4-methyl-6-oxo-2-(4-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxylate (PubChem CID 3727388) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is dimethyl 4-hydroxy-4-methyl-6-oxo-2-(4-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl 4-hydroxy-4-methyl-6-oxo-2-(4-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3727388 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | dimethyl 4-hydroxy-4-methyl-6-oxo-2-(4-phenylmethoxyphenyl)cyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)C1C(=O)CC(C)(O)C(C(=O)OC)C1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26O7/c1-24(28)13-18(25)20(22(26)29-2)19(21(24)23(27)30-3)16-9-11-17(12-10-16)31-14-15-7-5-4-6-8-15/h4-12,19-21,28H,13-14H2,1-3H3 |
| InChIKey | LNRRHEGBTGNKRX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|