C21H28O8 — CID 3113100
dimethyl 4-hydroxy-2-(3-methoxy-4-propoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 3113100) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is dimethyl 4-hydroxy-2-(3-methoxy-4-propoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | dimethyl 4-hydroxy-2-(3-methoxy-4-propoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3113100 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | dimethyl 4-hydroxy-2-(3-methoxy-4-propoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | CCCOc1ccc(C2C(C(=O)OC)C(=O)CC(C)(O)C2C(=O)OC)cc1OC |
| InChI | InChI=1S/C21H28O8/c1-6-9-29-14-8-7-12(10-15(14)26-3)16-17(19(23)27-4)13(22)11-21(2,25)18(16)20(24)28-5/h7-8,10,16-18,25H,6,9,11H2,1-5H3 |
| InChIKey | OVBSUKWMFCUTJV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|