C33H38N2O4 — CID 19225064
2-(4-tert-butylphenyl)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19225064) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19225064 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2C)C1c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H38N2O4/c1-20-11-7-9-13-24(20)34-30(37)28-26(36)19-33(6,39)29(31(38)35-25-14-10-8-12-21(25)2)27(28)22-15-17-23(18-16-22)32(3,4)5/h7-18,27-29,39H,19H2,1-6H3,(H,34,37)(H,35,38) |
| InChIKey | BNFJWYFBWLIHEZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|