C30H31N3O7 — CID 19225083
4-hydroxy-2-(4-methoxy-3-nitrophenyl)-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19225083) has the molecular formula C30H31N3O7 and a molecular weight of 545.59 g/mol. Its IUPAC name is 4-hydroxy-2-(4-methoxy-3-nitrophenyl)-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 4-hydroxy-2-(4-methoxy-3-nitrophenyl)-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19225083 |
| Molecular Formula | C30H31N3O7 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 4-hydroxy-2-(4-methoxy-3-nitrophenyl)-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | COc1ccc(C2C(C(=O)Nc3ccccc3C)C(=O)CC(C)(O)C2C(=O)Nc2ccccc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H31N3O7/c1-17-9-5-7-11-20(17)31-28(35)26-23(34)16-30(3,37)27(29(36)32-21-12-8-6-10-18(21)2)25(26)19-13-14-24(40-4)22(15-19)33(38)39/h5-15,25-27,37H,16H2,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | GHCMNSGAXMNSLN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|