C32H35N3O8 — CID 19224975
1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-2-(4-hydroxy-3-methoxy-5-nitrophenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19224975) has the molecular formula C32H35N3O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-2-(4-hydroxy-3-methoxy-5-nitrophenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-2-(4-hydroxy-3-methoxy-5-nitrophenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224975 |
| Molecular Formula | C32H35N3O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-2-(4-hydroxy-3-methoxy-5-nitrophenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | COc1cc(C2C(C(=O)Nc3ccc(C)cc3C)C(=O)CC(C)(O)C2C(=O)Nc2ccc(C)cc2C)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C32H35N3O8/c1-16-7-9-21(18(3)11-16)33-30(38)27-24(36)15-32(5,40)28(31(39)34-22-10-8-17(2)12-19(22)4)26(27)20-13-23(35(41)42)29(37)25(14-20)43-6/h7-14,26-28,37,40H,15H2,1-6H3,(H,33,38)(H,34,39) |
| InChIKey | LZNLTDVYTLXFPD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|