C30H34N2O4S — CID 19224923
1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-(3-methylthiophen-2-yl)-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19224923) has the molecular formula C30H34N2O4S and a molecular weight of 518.68 g/mol. Its IUPAC name is 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-(3-methylthiophen-2-yl)-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-(3-methylthiophen-2-yl)-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224923 |
| Molecular Formula | C30H34N2O4S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-(3-methylthiophen-2-yl)-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2C(=O)CC(C)(O)C(C(=O)Nc3ccc(C)cc3C)C2c2sccc2C)c(C)c1 |
| InChI | InChI=1S/C30H34N2O4S/c1-16-7-9-21(19(4)13-16)31-28(34)24-23(33)15-30(6,36)26(25(24)27-18(3)11-12-37-27)29(35)32-22-10-8-17(2)14-20(22)5/h7-14,24-26,36H,15H2,1-6H3,(H,31,34)(H,32,35) |
| InChIKey | YYAPCYZFMRTNRM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|