C34H40N2O5 — CID 19224950
1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-(3-propan-2-yloxyphenyl)cyclohexane-1,3-dicarboxamide (PubChem CID 19224950) has the molecular formula C34H40N2O5 and a molecular weight of 556.70 g/mol. Its IUPAC name is 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-(3-propan-2-yloxyphenyl)cyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-(3-propan-2-yloxyphenyl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224950 |
| Molecular Formula | C34H40N2O5 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-6-oxo-2-(3-propan-2-yloxyphenyl)cyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2C(=O)CC(C)(O)C(C(=O)Nc3ccc(C)cc3C)C2c2cccc(OC(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C34H40N2O5/c1-19(2)41-25-10-8-9-24(17-25)29-30(32(38)35-26-13-11-20(3)15-22(26)5)28(37)18-34(7,40)31(29)33(39)36-27-14-12-21(4)16-23(27)6/h8-17,19,29-31,40H,18H2,1-7H3,(H,35,38)(H,36,39) |
| InChIKey | KJTFAHBCRWVHRC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|