C32H34N2O6 — CID 19224936
2-[2,6-bis[(2,4-dimethylphenyl)carbamoyl]-3-hydroxy-3-methyl-5-oxocyclohexyl]benzoic acid (PubChem CID 19224936) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is 2-[2,6-bis[(2,4-dimethylphenyl)carbamoyl]-3-hydroxy-3-methyl-5-oxocyclohexyl]benzoic acid.
| Compound Name | 2-[2,6-bis[(2,4-dimethylphenyl)carbamoyl]-3-hydroxy-3-methyl-5-oxocyclohexyl]benzoic acid |
|---|---|
| PubChem CID | 19224936 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 2-[2,6-bis[(2,4-dimethylphenyl)carbamoyl]-3-hydroxy-3-methyl-5-oxocyclohexyl]benzoic acid |
| SMILES | Cc1ccc(NC(=O)C2C(=O)CC(C)(O)C(C(=O)Nc3ccc(C)cc3C)C2c2ccccc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C32H34N2O6/c1-17-10-12-23(19(3)14-17)33-29(36)27-25(35)16-32(5,40)28(26(27)21-8-6-7-9-22(21)31(38)39)30(37)34-24-13-11-18(2)15-20(24)4/h6-15,26-28,40H,16H2,1-5H3,(H,33,36)(H,34,37)(H,38,39) |
| InChIKey | PRLRSAYWGPGRLW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|