C28H29N3O4 — CID 51679928
(1S,2R,3S,4S)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxo-2-pyridin-2-ylcyclohexane-1,3-dicarboxamide (PubChem CID 51679928) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is (1S,2R,3S,4S)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxo-2-pyridin-2-ylcyclohexane-1,3-dicarboxamide.
| Compound Name | (1S,2R,3S,4S)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxo-2-pyridin-2-ylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 51679928 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (1S,2R,3S,4S)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxo-2-pyridin-2-ylcyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@@H](C(=O)Nc2ccccc2C)[C@H]1c1ccccn1 |
| InChI | InChI=1S/C28H29N3O4/c1-17-10-4-6-12-19(17)30-26(33)24-22(32)16-28(3,35)25(23(24)21-14-8-9-15-29-21)27(34)31-20-13-7-5-11-18(20)2/h4-15,23-25,35H,16H2,1-3H3,(H,30,33)(H,31,34)/t23-,24+,25+,28-/m0/s1 |
| InChIKey | ZSSZAWJSSFUYDM-FQJHJXCSSA-N |
| XLogP | 4.02 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|