C31H33ClN2O4 — CID 19233345
2-(2-chlorophenyl)-1-N,3-N-bis(2,3-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233345) has the molecular formula C31H33ClN2O4 and a molecular weight of 533.07 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-N,3-N-bis(2,3-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(2-chlorophenyl)-1-N,3-N-bis(2,3-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233345 |
| Molecular Formula | C31H33ClN2O4 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 2-(2-chlorophenyl)-1-N,3-N-bis(2,3-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2C(=O)CC(C)(O)C(C(=O)Nc3cccc(C)c3C)C2c2ccccc2Cl)c1C |
| InChI | InChI=1S/C31H33ClN2O4/c1-17-10-8-14-23(19(17)3)33-29(36)27-25(35)16-31(5,38)28(26(27)21-12-6-7-13-22(21)32)30(37)34-24-15-9-11-18(2)20(24)4/h6-15,26-28,38H,16H2,1-5H3,(H,33,36)(H,34,37) |
| InChIKey | FTZFCUSWKGVPSU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|