C31H31N3O4 — CID 19225050
4-hydroxy-2-(1H-indol-3-yl)-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19225050) has the molecular formula C31H31N3O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is 4-hydroxy-2-(1H-indol-3-yl)-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 4-hydroxy-2-(1H-indol-3-yl)-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19225050 |
| Molecular Formula | C31H31N3O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 4-hydroxy-2-(1H-indol-3-yl)-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2C)C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C31H31N3O4/c1-18-10-4-7-13-22(18)33-29(36)27-25(35)16-31(3,38)28(30(37)34-23-14-8-5-11-19(23)2)26(27)21-17-32-24-15-9-6-12-20(21)24/h4-15,17,26-28,32,38H,16H2,1-3H3,(H,33,36)(H,34,37) |
| InChIKey | OJBIKLISJMKCQC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|