C29H34N4O4 — CID 51699696
(1S,2S,3S,4S)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxo-2-(1,3,5-trimethylpyrazol-4-yl)cyclohexane-1,3-dicarboxamide (PubChem CID 51699696) has the molecular formula C29H34N4O4 and a molecular weight of 502.62 g/mol. Its IUPAC name is (1S,2S,3S,4S)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxo-2-(1,3,5-trimethylpyrazol-4-yl)cyclohexane-1,3-dicarboxamide.
| Compound Name | (1S,2S,3S,4S)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxo-2-(1,3,5-trimethylpyrazol-4-yl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 51699696 |
| Molecular Formula | C29H34N4O4 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (1S,2S,3S,4S)-4-hydroxy-4-methyl-1-N,3-N-bis(2-methylphenyl)-6-oxo-2-(1,3,5-trimethylpyrazol-4-yl)cyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@@H](C(=O)Nc2ccccc2C)[C@@H]1c1c(C)nn(C)c1C |
| InChI | InChI=1S/C29H34N4O4/c1-16-11-7-9-13-20(16)30-27(35)24-22(34)15-29(5,37)26(25(24)23-18(3)32-33(6)19(23)4)28(36)31-21-14-10-8-12-17(21)2/h7-14,24-26,37H,15H2,1-6H3,(H,30,35)(H,31,36)/t24-,25-,26-,29+/m1/s1 |
| InChIKey | CRZOLSVNWPMZBE-AQWTWLKTSA-N |
| XLogP | 3.97 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|