C28H29N3O6 — CID 19224800
4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxo-2-pyridin-2-ylcyclohexane-1,3-dicarboxamide (PubChem CID 19224800) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxo-2-pyridin-2-ylcyclohexane-1,3-dicarboxamide.
| Compound Name | 4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxo-2-pyridin-2-ylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224800 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxo-2-pyridin-2-ylcyclohexane-1,3-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2OC)C1c1ccccn1 |
| InChI | InChI=1S/C28H29N3O6/c1-28(35)16-20(32)24(26(33)30-17-10-4-6-13-21(17)36-2)23(19-12-8-9-15-29-19)25(28)27(34)31-18-11-5-7-14-22(18)37-3/h4-15,23-25,35H,16H2,1-3H3,(H,30,33)(H,31,34) |
| InChIKey | WNNGSSBYSIMDDL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|